C12H17N3O5S — CID 68799883
(3R)-3-[(5-amino-2-methoxyphenyl)sulfonylamino]pyrrolidine-1-carboxylic acid (PubChem CID 68799883) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is (3R)-3-[(5-amino-2-methoxyphenyl)sulfonylamino]pyrrolidine-1-carboxylic acid.
| Compound Name | (3R)-3-[(5-amino-2-methoxyphenyl)sulfonylamino]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68799883 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (3R)-3-[(5-amino-2-methoxyphenyl)sulfonylamino]pyrrolidine-1-carboxylic acid |
| SMILES | COc1ccc(N)cc1S(=O)(=O)N[C@@H]1CCN(C(=O)O)C1 |
| InChI | InChI=1S/C12H17N3O5S/c1-20-10-3-2-8(13)6-11(10)21(18,19)14-9-4-5-15(7-9)12(16)17/h2-3,6,9,14H,4-5,7,13H2,1H3,(H,16,17)/t9-/m1/s1 |
| InChIKey | JJRUAHZRGJKRDJ-SECBINFHSA-N |
| XLogP | 0.31 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|