C11H16N2O5S — CID 107213240
(3S,4R)-1-(5-amino-2-methoxyphenyl)sulfonylpyrrolidine-3,4-diol (PubChem CID 107213240) has the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. Its IUPAC name is (3S,4R)-1-(5-amino-2-methoxyphenyl)sulfonylpyrrolidine-3,4-diol.
| Compound Name | (3S,4R)-1-(5-amino-2-methoxyphenyl)sulfonylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 107213240 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | (3S,4R)-1-(5-amino-2-methoxyphenyl)sulfonylpyrrolidine-3,4-diol |
| SMILES | COc1ccc(N)cc1S(=O)(=O)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C11H16N2O5S/c1-18-10-3-2-7(12)4-11(10)19(16,17)13-5-8(14)9(15)6-13/h2-4,8-9,14-15H,5-6,12H2,1H3/t8-,9+ |
| InChIKey | OLCFYPOFOHVMAS-DTORHVGOSA-N |
| XLogP | -1.00 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|