C15H15FN2O3S — CID 156859799
3-[(5-fluoro-1,3-dihydroisoindol-2-yl)sulfonyl]-4-methoxyaniline (PubChem CID 156859799) has the molecular formula C15H15FN2O3S and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-[(5-fluoro-1,3-dihydroisoindol-2-yl)sulfonyl]-4-methoxyaniline.
| Compound Name | 3-[(5-fluoro-1,3-dihydroisoindol-2-yl)sulfonyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 156859799 |
| Molecular Formula | C15H15FN2O3S |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 3-[(5-fluoro-1,3-dihydroisoindol-2-yl)sulfonyl]-4-methoxyaniline |
| SMILES | COc1ccc(N)cc1S(=O)(=O)N1Cc2ccc(F)cc2C1 |
| InChI | InChI=1S/C15H15FN2O3S/c1-21-14-5-4-13(17)7-15(14)22(19,20)18-8-10-2-3-12(16)6-11(10)9-18/h2-7H,8-9,17H2,1H3 |
| InChIKey | YJNIMTBEAAIJTF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|