C12H16N2O6S — CID 107213225
methyl 5-amino-2-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]sulfonylbenzoate (PubChem CID 107213225) has the molecular formula C12H16N2O6S and a molecular weight of 316.34 g/mol. Its IUPAC name is methyl 5-amino-2-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]sulfonylbenzoate.
| Compound Name | methyl 5-amino-2-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 107213225 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | methyl 5-amino-2-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]sulfonylbenzoate |
| SMILES | COC(=O)c1cc(N)ccc1S(=O)(=O)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C12H16N2O6S/c1-20-12(17)8-4-7(13)2-3-11(8)21(18,19)14-5-9(15)10(16)6-14/h2-4,9-10,15-16H,5-6,13H2,1H3/t9-,10+ |
| InChIKey | YLLSTYUPAQBPKC-AOOOYVTPSA-N |
| XLogP | -1.22 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|