C12H15NO6S — CID 106672231
methyl 4-(3,4-dihydroxypyrrolidin-1-yl)sulfonylbenzoate (PubChem CID 106672231) has the molecular formula C12H15NO6S and a molecular weight of 301.32 g/mol. Its IUPAC name is methyl 4-(3,4-dihydroxypyrrolidin-1-yl)sulfonylbenzoate.
| Compound Name | methyl 4-(3,4-dihydroxypyrrolidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 106672231 |
| Molecular Formula | C12H15NO6S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | methyl 4-(3,4-dihydroxypyrrolidin-1-yl)sulfonylbenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CC(O)C(O)C2)cc1 |
| InChI | InChI=1S/C12H15NO6S/c1-19-12(16)8-2-4-9(5-3-8)20(17,18)13-6-10(14)11(15)7-13/h2-5,10-11,14-15H,6-7H2,1H3 |
| InChIKey | CRHDRPVYNIVOKS-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |