C14H16N4O4S — CID 121178868
methyl 4-[3-(triazol-2-yl)pyrrolidin-1-yl]sulfonylbenzoate (PubChem CID 121178868) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is methyl 4-[3-(triazol-2-yl)pyrrolidin-1-yl]sulfonylbenzoate.
| Compound Name | methyl 4-[3-(triazol-2-yl)pyrrolidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 121178868 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | methyl 4-[3-(triazol-2-yl)pyrrolidin-1-yl]sulfonylbenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CCC(n3nccn3)C2)cc1 |
| InChI | InChI=1S/C14H16N4O4S/c1-22-14(19)11-2-4-13(5-3-11)23(20,21)17-9-6-12(10-17)18-15-7-8-16-18/h2-5,7-8,12H,6,9-10H2,1H3 |
| InChIKey | FRNKYRSYPQNVTB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |