C14H16N4O3S — CID 121178845
1-[3-[3-(triazol-2-yl)pyrrolidin-1-yl]sulfonylphenyl]ethanone (PubChem CID 121178845) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is 1-[3-[3-(triazol-2-yl)pyrrolidin-1-yl]sulfonylphenyl]ethanone.
| Compound Name | 1-[3-[3-(triazol-2-yl)pyrrolidin-1-yl]sulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 121178845 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1-[3-[3-(triazol-2-yl)pyrrolidin-1-yl]sulfonylphenyl]ethanone |
| SMILES | CC(=O)c1cccc(S(=O)(=O)N2CCC(n3nccn3)C2)c1 |
| InChI | InChI=1S/C14H16N4O3S/c1-11(19)12-3-2-4-14(9-12)22(20,21)17-8-5-13(10-17)18-15-6-7-16-18/h2-4,6-7,9,13H,5,8,10H2,1H3 |
| InChIKey | CAJYTOLBQUEJLS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |