C18H20N2O4S — CID 120766596
methyl 4-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]sulfonylbenzoate (PubChem CID 120766596) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is methyl 4-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]sulfonylbenzoate.
| Compound Name | methyl 4-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 120766596 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | methyl 4-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]sulfonylbenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2C[C@@H](N)[C@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C18H20N2O4S/c1-24-18(21)14-7-9-15(10-8-14)25(22,23)20-11-16(17(19)12-20)13-5-3-2-4-6-13/h2-10,16-17H,11-12,19H2,1H3/t16-,17+/m0/s1 |
| InChIKey | SECRDLOQIZMDDZ-DLBZAZTESA-N |
| XLogP | 1.59 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |