C19H22N2O5S — CID 120766889
methyl 4-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]sulfonyl-3-methoxybenzoate (PubChem CID 120766889) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is methyl 4-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]sulfonyl-3-methoxybenzoate.
| Compound Name | methyl 4-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]sulfonyl-3-methoxybenzoate |
|---|---|
| PubChem CID | 120766889 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | methyl 4-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]sulfonyl-3-methoxybenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2C[C@@H](N)[C@H](c3ccccc3)C2)c(OC)c1 |
| InChI | InChI=1S/C19H22N2O5S/c1-25-17-10-14(19(22)26-2)8-9-18(17)27(23,24)21-11-15(16(20)12-21)13-6-4-3-5-7-13/h3-10,15-16H,11-12,20H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | FUZNWLNQTNGFLU-JKSUJKDBSA-N |
| XLogP | 1.60 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |