C18H22N2O3S — CID 120766979
(3S,4R)-1-[2-(methoxymethyl)phenyl]sulfonyl-4-phenylpyrrolidin-3-amine (PubChem CID 120766979) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is (3S,4R)-1-[2-(methoxymethyl)phenyl]sulfonyl-4-phenylpyrrolidin-3-amine.
| Compound Name | (3S,4R)-1-[2-(methoxymethyl)phenyl]sulfonyl-4-phenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 120766979 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (3S,4R)-1-[2-(methoxymethyl)phenyl]sulfonyl-4-phenylpyrrolidin-3-amine |
| SMILES | COCc1ccccc1S(=O)(=O)N1C[C@@H](N)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C18H22N2O3S/c1-23-13-15-9-5-6-10-18(15)24(21,22)20-11-16(17(19)12-20)14-7-3-2-4-8-14/h2-10,16-17H,11-13,19H2,1H3/t16-,17+/m0/s1 |
| InChIKey | MZPCSIZWVNYUMZ-DLBZAZTESA-N |
| XLogP | 1.95 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |