C16H16F2N2O2S — CID 120767014
(3S,4R)-1-(3,5-difluorophenyl)sulfonyl-4-phenylpyrrolidin-3-amine (PubChem CID 120767014) has the molecular formula C16H16F2N2O2S and a molecular weight of 338.38 g/mol. Its IUPAC name is (3S,4R)-1-(3,5-difluorophenyl)sulfonyl-4-phenylpyrrolidin-3-amine.
| Compound Name | (3S,4R)-1-(3,5-difluorophenyl)sulfonyl-4-phenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 120767014 |
| Molecular Formula | C16H16F2N2O2S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (3S,4R)-1-(3,5-difluorophenyl)sulfonyl-4-phenylpyrrolidin-3-amine |
| SMILES | N[C@@H]1CN(S(=O)(=O)c2cc(F)cc(F)c2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H16F2N2O2S/c17-12-6-13(18)8-14(7-12)23(21,22)20-9-15(16(19)10-20)11-4-2-1-3-5-11/h1-8,15-16H,9-10,19H2/t15-,16+/m0/s1 |
| InChIKey | BOZNJEITWAUGPM-JKSUJKDBSA-N |
| XLogP | 2.08 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |