C19H24N2O2S — CID 120766881
(3S,4R)-4-phenyl-1-(3-propan-2-ylphenyl)sulfonylpyrrolidin-3-amine (PubChem CID 120766881) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is (3S,4R)-4-phenyl-1-(3-propan-2-ylphenyl)sulfonylpyrrolidin-3-amine.
| Compound Name | (3S,4R)-4-phenyl-1-(3-propan-2-ylphenyl)sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 120766881 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (3S,4R)-4-phenyl-1-(3-propan-2-ylphenyl)sulfonylpyrrolidin-3-amine |
| SMILES | CC(C)c1cccc(S(=O)(=O)N2C[C@@H](N)[C@H](c3ccccc3)C2)c1 |
| InChI | InChI=1S/C19H24N2O2S/c1-14(2)16-9-6-10-17(11-16)24(22,23)21-12-18(19(20)13-21)15-7-4-3-5-8-15/h3-11,14,18-19H,12-13,20H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | OXONMZFRRDSDGO-RBUKOAKNSA-N |
| XLogP | 2.93 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |