C16H18ClFN2O2S — CID 120766465
(3S,4R)-1-(3-fluorophenyl)sulfonyl-4-phenylpyrrolidin-3-amine;hydrochloride (PubChem CID 120766465) has the molecular formula C16H18ClFN2O2S and a molecular weight of 356.85 g/mol. Its IUPAC name is (3S,4R)-1-(3-fluorophenyl)sulfonyl-4-phenylpyrrolidin-3-amine;hydrochloride.
| Compound Name | (3S,4R)-1-(3-fluorophenyl)sulfonyl-4-phenylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120766465 |
| Molecular Formula | C16H18ClFN2O2S |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (3S,4R)-1-(3-fluorophenyl)sulfonyl-4-phenylpyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.N[C@@H]1CN(S(=O)(=O)c2cccc(F)c2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H17FN2O2S.ClH/c17-13-7-4-8-14(9-13)22(20,21)19-10-15(16(18)11-19)12-5-2-1-3-6-12;/h1-9,15-16H,10-11,18H2;1H/t15-,16+;/m0./s1 |
| InChIKey | OIIYBZOPIRBECF-IDVLALEDSA-N |
| XLogP | 2.36 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |