C17H19FN2O2S — CID 120765692
[(3R,4R)-1-(3-fluorophenyl)sulfonyl-4-phenylpyrrolidin-3-yl]methanamine (PubChem CID 120765692) has the molecular formula C17H19FN2O2S and a molecular weight of 334.42 g/mol. Its IUPAC name is [(3R,4R)-1-(3-fluorophenyl)sulfonyl-4-phenylpyrrolidin-3-yl]methanamine.
| Compound Name | [(3R,4R)-1-(3-fluorophenyl)sulfonyl-4-phenylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 120765692 |
| Molecular Formula | C17H19FN2O2S |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | [(3R,4R)-1-(3-fluorophenyl)sulfonyl-4-phenylpyrrolidin-3-yl]methanamine |
| SMILES | NC[C@@H]1CN(S(=O)(=O)c2cccc(F)c2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H19FN2O2S/c18-15-7-4-8-16(9-15)23(21,22)20-11-14(10-19)17(12-20)13-5-2-1-3-6-13/h1-9,14,17H,10-12,19H2/t14-,17+/m1/s1 |
| InChIKey | MQRNZYQLHSRRNB-PBHICJAKSA-N |
| XLogP | 2.19 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |