C17H18F2N2O2S — CID 120766238
[(3R,4R)-1-(2,3-difluorophenyl)sulfonyl-4-phenylpyrrolidin-3-yl]methanamine (PubChem CID 120766238) has the molecular formula C17H18F2N2O2S and a molecular weight of 352.41 g/mol. Its IUPAC name is [(3R,4R)-1-(2,3-difluorophenyl)sulfonyl-4-phenylpyrrolidin-3-yl]methanamine.
| Compound Name | [(3R,4R)-1-(2,3-difluorophenyl)sulfonyl-4-phenylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 120766238 |
| Molecular Formula | C17H18F2N2O2S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | [(3R,4R)-1-(2,3-difluorophenyl)sulfonyl-4-phenylpyrrolidin-3-yl]methanamine |
| SMILES | NC[C@@H]1CN(S(=O)(=O)c2cccc(F)c2F)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H18F2N2O2S/c18-15-7-4-8-16(17(15)19)24(22,23)21-10-13(9-20)14(11-21)12-5-2-1-3-6-12/h1-8,13-14H,9-11,20H2/t13-,14+/m1/s1 |
| InChIKey | FMOXQZBZOMUXPT-KGLIPLIRSA-N |
| XLogP | 2.33 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |