C17H17F3N2O2S — CID 120767028
(3S,4R)-4-phenyl-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-amine (PubChem CID 120767028) has the molecular formula C17H17F3N2O2S and a molecular weight of 370.40 g/mol. Its IUPAC name is (3S,4R)-4-phenyl-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-amine.
| Compound Name | (3S,4R)-4-phenyl-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 120767028 |
| Molecular Formula | C17H17F3N2O2S |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (3S,4R)-4-phenyl-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-amine |
| SMILES | N[C@@H]1CN(S(=O)(=O)c2ccccc2C(F)(F)F)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H17F3N2O2S/c18-17(19,20)14-8-4-5-9-16(14)25(23,24)22-10-13(15(21)11-22)12-6-2-1-3-7-12/h1-9,13,15H,10-11,21H2/t13-,15+/m0/s1 |
| InChIKey | LDOYYSCXBSQSKT-DZGCQCFKSA-N |
| XLogP | 2.82 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |