C11H11BrF3NO2S — CID 80667317
3-bromo-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine (PubChem CID 80667317) has the molecular formula C11H11BrF3NO2S and a molecular weight of 358.18 g/mol. Its IUPAC name is 3-bromo-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine.
| Compound Name | 3-bromo-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine |
|---|---|
| PubChem CID | 80667317 |
| Molecular Formula | C11H11BrF3NO2S |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | 3-bromo-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine |
| SMILES | O=S(=O)(c1ccccc1C(F)(F)F)N1CCC(Br)C1 |
| InChI | InChI=1S/C11H11BrF3NO2S/c12-8-5-6-16(7-8)19(17,18)10-4-2-1-3-9(10)11(13,14)15/h1-4,8H,5-7H2 |
| InChIKey | ZNUIXDXFZYOYKN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|