C11H12F3NO4S — CID 79410488
(3R,4S)-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-3,4-diol (PubChem CID 79410488) has the molecular formula C11H12F3NO4S and a molecular weight of 311.28 g/mol. Its IUPAC name is (3R,4S)-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-3,4-diol.
| Compound Name | (3R,4S)-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 79410488 |
| Molecular Formula | C11H12F3NO4S |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | (3R,4S)-1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-3,4-diol |
| SMILES | O=S(=O)(c1ccccc1C(F)(F)F)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C11H12F3NO4S/c12-11(13,14)7-3-1-2-4-10(7)20(18,19)15-5-8(16)9(17)6-15/h1-4,8-9,16-17H,5-6H2/t8-,9+ |
| InChIKey | LQBWHFPITMUNGE-DTORHVGOSA-N |
| XLogP | 0.43 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |