C13H17F3N2O4S2 — CID 24678902
N-[1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]methanesulfonamide (PubChem CID 24678902) has the molecular formula C13H17F3N2O4S2 and a molecular weight of 386.42 g/mol. Its IUPAC name is N-[1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 24678902 |
| Molecular Formula | C13H17F3N2O4S2 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N-[1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCN(S(=O)(=O)c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H17F3N2O4S2/c1-23(19,20)17-10-6-8-18(9-7-10)24(21,22)12-5-3-2-4-11(12)13(14,15)16/h2-5,10,17H,6-9H2,1H3 |
| InChIKey | CYBFUGFOCPVTIJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |