C16H17F3N4O2S — CID 171336242
N-[1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]pyrimidin-4-amine (PubChem CID 171336242) has the molecular formula C16H17F3N4O2S and a molecular weight of 386.40 g/mol. Its IUPAC name is N-[1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]pyrimidin-4-amine.
| Compound Name | N-[1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 171336242 |
| Molecular Formula | C16H17F3N4O2S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | N-[1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]pyrimidin-4-amine |
| SMILES | O=S(=O)(c1ccccc1C(F)(F)F)N1CCC(Nc2ccncn2)CC1 |
| InChI | InChI=1S/C16H17F3N4O2S/c17-16(18,19)13-3-1-2-4-14(13)26(24,25)23-9-6-12(7-10-23)22-15-5-8-20-11-21-15/h1-5,8,11-12H,6-7,9-10H2,(H,20,21,22) |
| InChIKey | SMQHYCYMCREGMQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |