C18H19F3N4O2S — CID 72717221
4-cyclopropyl-6-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyrimidine (PubChem CID 72717221) has the molecular formula C18H19F3N4O2S and a molecular weight of 412.44 g/mol. Its IUPAC name is 4-cyclopropyl-6-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyrimidine.
| Compound Name | 4-cyclopropyl-6-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 72717221 |
| Molecular Formula | C18H19F3N4O2S |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 4-cyclopropyl-6-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyrimidine |
| SMILES | O=S(=O)(c1ccccc1C(F)(F)F)N1CCN(c2cc(C3CC3)ncn2)CC1 |
| InChI | InChI=1S/C18H19F3N4O2S/c19-18(20,21)14-3-1-2-4-16(14)28(26,27)25-9-7-24(8-10-25)17-11-15(13-5-6-13)22-12-23-17/h1-4,11-13H,5-10H2 |
| InChIKey | BYVUSBNMUFJJGV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |