C16H19ClN4O3S — CID 171336312
N-[1-(2-chlorophenyl)sulfonylpiperidin-4-yl]-6-methoxypyrimidin-4-amine (PubChem CID 171336312) has the molecular formula C16H19ClN4O3S and a molecular weight of 382.87 g/mol. Its IUPAC name is N-[1-(2-chlorophenyl)sulfonylpiperidin-4-yl]-6-methoxypyrimidin-4-amine.
| Compound Name | N-[1-(2-chlorophenyl)sulfonylpiperidin-4-yl]-6-methoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 171336312 |
| Molecular Formula | C16H19ClN4O3S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-[1-(2-chlorophenyl)sulfonylpiperidin-4-yl]-6-methoxypyrimidin-4-amine |
| SMILES | COc1cc(NC2CCN(S(=O)(=O)c3ccccc3Cl)CC2)ncn1 |
| InChI | InChI=1S/C16H19ClN4O3S/c1-24-16-10-15(18-11-19-16)20-12-6-8-21(9-7-12)25(22,23)14-5-3-2-4-13(14)17/h2-5,10-12H,6-9H2,1H3,(H,18,19,20) |
| InChIKey | GIFNBCHKVRPLDY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |