C19H20N6O2 — CID 126887928
[4-[(6-methoxypyrimidin-4-yl)amino]piperidin-1-yl]-quinoxalin-2-ylmethanone (PubChem CID 126887928) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is [4-[(6-methoxypyrimidin-4-yl)amino]piperidin-1-yl]-quinoxalin-2-ylmethanone.
| Compound Name | [4-[(6-methoxypyrimidin-4-yl)amino]piperidin-1-yl]-quinoxalin-2-ylmethanone |
|---|---|
| PubChem CID | 126887928 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | [4-[(6-methoxypyrimidin-4-yl)amino]piperidin-1-yl]-quinoxalin-2-ylmethanone |
| SMILES | COc1cc(NC2CCN(C(=O)c3cnc4ccccc4n3)CC2)ncn1 |
| InChI | InChI=1S/C19H20N6O2/c1-27-18-10-17(21-12-22-18)23-13-6-8-25(9-7-13)19(26)16-11-20-14-4-2-3-5-15(14)24-16/h2-5,10-13H,6-9H2,1H3,(H,21,22,23) |
| InChIKey | HNEBRSAJNMHCBE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |