C18H23ClN2O3S — CID 120767116
(3S,4R)-1-(4-ethoxyphenyl)sulfonyl-4-phenylpyrrolidin-3-amine;hydrochloride (PubChem CID 120767116) has the molecular formula C18H23ClN2O3S and a molecular weight of 382.91 g/mol. Its IUPAC name is (3S,4R)-1-(4-ethoxyphenyl)sulfonyl-4-phenylpyrrolidin-3-amine;hydrochloride.
| Compound Name | (3S,4R)-1-(4-ethoxyphenyl)sulfonyl-4-phenylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120767116 |
| Molecular Formula | C18H23ClN2O3S |
| Molecular Weight | 382.91 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | (3S,4R)-1-(4-ethoxyphenyl)sulfonyl-4-phenylpyrrolidin-3-amine;hydrochloride |
| SMILES | CCOc1ccc(S(=O)(=O)N2C[C@@H](N)[C@H](c3ccccc3)C2)cc1.Cl |
| InChI | InChI=1S/C18H22N2O3S.ClH/c1-2-23-15-8-10-16(11-9-15)24(21,22)20-12-17(18(19)13-20)14-6-4-3-5-7-14;/h3-11,17-18H,2,12-13,19H2,1H3;1H/t17-,18+;/m0./s1 |
| InChIKey | TTXKFSKYXITJDZ-CJRXIRLBSA-N |
| XLogP | 2.62 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.91 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |