C15H17F2NO4S — CID 126855619
methyl 4-[(2,2-difluoro-6-azaspiro[2.5]octan-6-yl)sulfonyl]benzoate (PubChem CID 126855619) has the molecular formula C15H17F2NO4S and a molecular weight of 345.37 g/mol. Its IUPAC name is methyl 4-[(2,2-difluoro-6-azaspiro[2.5]octan-6-yl)sulfonyl]benzoate.
| Compound Name | methyl 4-[(2,2-difluoro-6-azaspiro[2.5]octan-6-yl)sulfonyl]benzoate |
|---|---|
| PubChem CID | 126855619 |
| Molecular Formula | C15H17F2NO4S |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | methyl 4-[(2,2-difluoro-6-azaspiro[2.5]octan-6-yl)sulfonyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CCC3(CC2)CC3(F)F)cc1 |
| InChI | InChI=1S/C15H17F2NO4S/c1-22-13(19)11-2-4-12(5-3-11)23(20,21)18-8-6-14(7-9-18)10-15(14,16)17/h2-5H,6-10H2,1H3 |
| InChIKey | URYNTVBIBFPIDS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |