C16H23ClN2O4S — CID 120584080
methyl 4-[(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)sulfonyl]benzoate;hydrochloride (PubChem CID 120584080) has the molecular formula C16H23ClN2O4S and a molecular weight of 374.89 g/mol. Its IUPAC name is methyl 4-[(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)sulfonyl]benzoate;hydrochloride.
| Compound Name | methyl 4-[(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)sulfonyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 120584080 |
| Molecular Formula | C16H23ClN2O4S |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | methyl 4-[(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)sulfonyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CC3CCCC(N)C3C2)cc1.Cl |
| InChI | InChI=1S/C16H22N2O4S.ClH/c1-22-16(19)11-5-7-13(8-6-11)23(20,21)18-9-12-3-2-4-15(17)14(12)10-18;/h5-8,12,14-15H,2-4,9-10,17H2,1H3;1H |
| InChIKey | MXVVVYQESYJGHJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |