C12H16N2O5S — CID 102930731
methyl 4-amino-2-morpholin-4-ylsulfonylbenzoate (PubChem CID 102930731) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is methyl 4-amino-2-morpholin-4-ylsulfonylbenzoate.
| Compound Name | methyl 4-amino-2-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 102930731 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | methyl 4-amino-2-morpholin-4-ylsulfonylbenzoate |
| SMILES | COC(=O)c1ccc(N)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C12H16N2O5S/c1-18-12(15)10-3-2-9(13)8-11(10)20(16,17)14-4-6-19-7-5-14/h2-3,8H,4-7,13H2,1H3 |
| InChIKey | YNLRPCRHGNNOMR-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|