C16H26N2O4S — CID 112504854
2,5-dimethoxy-N-(2-methyl-2-pyrrolidin-1-ylpropyl)benzenesulfonamide (PubChem CID 112504854) has the molecular formula C16H26N2O4S and a molecular weight of 342.46 g/mol. Its IUPAC name is 2,5-dimethoxy-N-(2-methyl-2-pyrrolidin-1-ylpropyl)benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-(2-methyl-2-pyrrolidin-1-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 112504854 |
| Molecular Formula | C16H26N2O4S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2,5-dimethoxy-N-(2-methyl-2-pyrrolidin-1-ylpropyl)benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NCC(C)(C)N2CCCC2)c1 |
| InChI | InChI=1S/C16H26N2O4S/c1-16(2,18-9-5-6-10-18)12-17-23(19,20)15-11-13(21-3)7-8-14(15)22-4/h7-8,11,17H,5-6,9-10,12H2,1-4H3 |
| InChIKey | YXAJPCXCCKSSPJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |