C23H25NO5S — CID 90497578
N-[2-hydroxy-2-(4-phenylphenyl)propyl]-2,5-dimethoxybenzenesulfonamide (PubChem CID 90497578) has the molecular formula C23H25NO5S and a molecular weight of 427.52 g/mol. Its IUPAC name is N-[2-hydroxy-2-(4-phenylphenyl)propyl]-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-[2-hydroxy-2-(4-phenylphenyl)propyl]-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 90497578 |
| Molecular Formula | C23H25NO5S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | N-[2-hydroxy-2-(4-phenylphenyl)propyl]-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NCC(C)(O)c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C23H25NO5S/c1-23(25,19-11-9-18(10-12-19)17-7-5-4-6-8-17)16-24-30(26,27)22-15-20(28-2)13-14-21(22)29-3/h4-15,24-25H,16H2,1-3H3 |
| InChIKey | JUABMSYMTSFUST-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |