C17H21NO4S — CID 95368051
N-[(2R)-2-hydroxy-2-phenylpropyl]-4-methoxy-3-methylbenzenesulfonamide (PubChem CID 95368051) has the molecular formula C17H21NO4S and a molecular weight of 335.43 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-2-phenylpropyl]-4-methoxy-3-methylbenzenesulfonamide.
| Compound Name | N-[(2R)-2-hydroxy-2-phenylpropyl]-4-methoxy-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 95368051 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N-[(2R)-2-hydroxy-2-phenylpropyl]-4-methoxy-3-methylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC[C@](C)(O)c2ccccc2)cc1C |
| InChI | InChI=1S/C17H21NO4S/c1-13-11-15(9-10-16(13)22-3)23(20,21)18-12-17(2,19)14-7-5-4-6-8-14/h4-11,18-19H,12H2,1-3H3/t17-/m0/s1 |
| InChIKey | ZZGSYTBRXDGFGB-KRWDZBQOSA-N |
| XLogP | 2.19 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |