C17H21NO3S — CID 95368044
N-[(2S)-2-hydroxy-2-phenylpropyl]-2,4-dimethylbenzenesulfonamide (PubChem CID 95368044) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is N-[(2S)-2-hydroxy-2-phenylpropyl]-2,4-dimethylbenzenesulfonamide.
| Compound Name | N-[(2S)-2-hydroxy-2-phenylpropyl]-2,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 95368044 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-[(2S)-2-hydroxy-2-phenylpropyl]-2,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC[C@@](C)(O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C17H21NO3S/c1-13-9-10-16(14(2)11-13)22(20,21)18-12-17(3,19)15-7-5-4-6-8-15/h4-11,18-19H,12H2,1-3H3/t17-/m1/s1 |
| InChIKey | ALYABTKSFBOTOF-QGZVFWFLSA-N |
| XLogP | 2.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |