C11H15NO7S — CID 66165859
3-[(2,5-dimethoxyphenyl)sulfonylamino]-2-hydroxypropanoic acid (PubChem CID 66165859) has the molecular formula C11H15NO7S and a molecular weight of 305.31 g/mol. Its IUPAC name is 3-[(2,5-dimethoxyphenyl)sulfonylamino]-2-hydroxypropanoic acid.
| Compound Name | 3-[(2,5-dimethoxyphenyl)sulfonylamino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 66165859 |
| Molecular Formula | C11H15NO7S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 3-[(2,5-dimethoxyphenyl)sulfonylamino]-2-hydroxypropanoic acid |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NCC(O)C(=O)O)c1 |
| InChI | InChI=1S/C11H15NO7S/c1-18-7-3-4-9(19-2)10(5-7)20(16,17)12-6-8(13)11(14)15/h3-5,8,12-13H,6H2,1-2H3,(H,14,15) |
| InChIKey | BQPCYIWCVLDOHC-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |