C12H19NO5S — CID 64912067
N-(3-hydroxybutyl)-2,5-dimethoxybenzenesulfonamide (PubChem CID 64912067) has the molecular formula C12H19NO5S and a molecular weight of 289.35 g/mol. Its IUPAC name is N-(3-hydroxybutyl)-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-(3-hydroxybutyl)-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 64912067 |
| Molecular Formula | C12H19NO5S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-(3-hydroxybutyl)-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NCCC(C)O)c1 |
| InChI | InChI=1S/C12H19NO5S/c1-9(14)6-7-13-19(15,16)12-8-10(17-2)4-5-11(12)18-3/h4-5,8-9,13-14H,6-7H2,1-3H3 |
| InChIKey | MDQPUIQPFYKFSI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |