C15H20N2O4S — CID 110721113
2,5-dimethoxy-N-(3-pyrrol-1-ylpropyl)benzenesulfonamide (PubChem CID 110721113) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is 2,5-dimethoxy-N-(3-pyrrol-1-ylpropyl)benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-(3-pyrrol-1-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110721113 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2,5-dimethoxy-N-(3-pyrrol-1-ylpropyl)benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NCCCn2cccc2)c1 |
| InChI | InChI=1S/C15H20N2O4S/c1-20-13-6-7-14(21-2)15(12-13)22(18,19)16-8-5-11-17-9-3-4-10-17/h3-4,6-7,9-10,12,16H,5,8,11H2,1-2H3 |
| InChIKey | FNXHWTDVHISHNS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|