C19H23N3O4S — CID 110292045
2,5-dimethoxy-N-[3-(2-methylbenzimidazol-1-yl)propyl]benzenesulfonamide (PubChem CID 110292045) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is 2,5-dimethoxy-N-[3-(2-methylbenzimidazol-1-yl)propyl]benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-[3-(2-methylbenzimidazol-1-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110292045 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2,5-dimethoxy-N-[3-(2-methylbenzimidazol-1-yl)propyl]benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NCCCn2c(C)nc3ccccc32)c1 |
| InChI | InChI=1S/C19H23N3O4S/c1-14-21-16-7-4-5-8-17(16)22(14)12-6-11-20-27(23,24)19-13-15(25-2)9-10-18(19)26-3/h4-5,7-10,13,20H,6,11-12H2,1-3H3 |
| InChIKey | PNOWXVHGPFHWOQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|