C11H17NO6S — CID 66175426
N-(2,3-dihydroxypropyl)-2,5-dimethoxybenzenesulfonamide (PubChem CID 66175426) has the molecular formula C11H17NO6S and a molecular weight of 291.33 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-(2,3-dihydroxypropyl)-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 66175426 |
| Molecular Formula | C11H17NO6S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NCC(O)CO)c1 |
| InChI | InChI=1S/C11H17NO6S/c1-17-9-3-4-10(18-2)11(5-9)19(15,16)12-6-8(14)7-13/h3-5,8,12-14H,6-7H2,1-2H3 |
| InChIKey | QYYDGRUVPSBOCU-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |