C10H15NO5S — CID 60700414
N-ethoxy-2,5-dimethoxybenzenesulfonamide (PubChem CID 60700414) has the molecular formula C10H15NO5S and a molecular weight of 261.30 g/mol. Its IUPAC name is N-ethoxy-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-ethoxy-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 60700414 |
| Molecular Formula | C10H15NO5S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | N-ethoxy-2,5-dimethoxybenzenesulfonamide |
| SMILES | CCONS(=O)(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C10H15NO5S/c1-4-16-11-17(12,13)10-7-8(14-2)5-6-9(10)15-3/h5-7,11H,4H2,1-3H3 |
| InChIKey | HTFSHDZHKZTMOK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|