C16H20N2O4S — CID 120715614
N-[2-(4-aminophenyl)ethyl]-2,5-dimethoxybenzenesulfonamide (PubChem CID 120715614) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 120715614 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NCCc2ccc(N)cc2)c1 |
| InChI | InChI=1S/C16H20N2O4S/c1-21-14-7-8-15(22-2)16(11-14)23(19,20)18-10-9-12-3-5-13(17)6-4-12/h3-8,11,18H,9-10,17H2,1-2H3 |
| InChIKey | ZHRJLDFYPAUEED-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|