C16H18ClNO4S — CID 17435586
N-[2-(4-chlorophenyl)ethyl]-2,4-dimethoxybenzenesulfonamide (PubChem CID 17435586) has the molecular formula C16H18ClNO4S and a molecular weight of 355.84 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 17435586 |
| Molecular Formula | C16H18ClNO4S |
| Molecular Weight | 355.84 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCc2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C16H18ClNO4S/c1-21-14-7-8-16(15(11-14)22-2)23(19,20)18-10-9-12-3-5-13(17)6-4-12/h3-8,11,18H,9-10H2,1-2H3 |
| InChIKey | YCZTWWGWXSJXIM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.84 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |