C16H16Cl3NO4S — CID 2729546
2,3,4-trichloro-N-[2-(3,4-dimethoxyphenyl)ethyl]benzenesulfonamide (PubChem CID 2729546) has the molecular formula C16H16Cl3NO4S and a molecular weight of 424.73 g/mol. Its IUPAC name is 2,3,4-trichloro-N-[2-(3,4-dimethoxyphenyl)ethyl]benzenesulfonamide.
| Compound Name | 2,3,4-trichloro-N-[2-(3,4-dimethoxyphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2729546 |
| Molecular Formula | C16H16Cl3NO4S |
| Molecular Weight | 424.73 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | 2,3,4-trichloro-N-[2-(3,4-dimethoxyphenyl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(CCNS(=O)(=O)c2ccc(Cl)c(Cl)c2Cl)cc1OC |
| InChI | InChI=1S/C16H16Cl3NO4S/c1-23-12-5-3-10(9-13(12)24-2)7-8-20-25(21,22)14-6-4-11(17)15(18)16(14)19/h3-6,9,20H,7-8H2,1-2H3 |
| InChIKey | ONZLGXDUKKISJO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.73 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|