C21H26N2O6S — CID 99979592
3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-4-pyrrolidin-1-ylbenzoic acid (PubChem CID 99979592) has the molecular formula C21H26N2O6S and a molecular weight of 434.51 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-4-pyrrolidin-1-ylbenzoic acid.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-4-pyrrolidin-1-ylbenzoic acid |
|---|---|
| PubChem CID | 99979592 |
| Molecular Formula | C21H26N2O6S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-4-pyrrolidin-1-ylbenzoic acid |
| SMILES | COc1ccc(CCNS(=O)(=O)c2cc(C(=O)O)ccc2N2CCCC2)cc1OC |
| InChI | InChI=1S/C21H26N2O6S/c1-28-18-8-5-15(13-19(18)29-2)9-10-22-30(26,27)20-14-16(21(24)25)6-7-17(20)23-11-3-4-12-23/h5-8,13-14,22H,3-4,9-12H2,1-2H3,(H,24,25) |
| InChIKey | DKFILKTWTOCSKI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |