C27H39N3O5S — CID 46110215
N-[3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-4-pyrrolidin-1-ylphenyl]heptanamide (PubChem CID 46110215) has the molecular formula C27H39N3O5S and a molecular weight of 517.69 g/mol. Its IUPAC name is N-[3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-4-pyrrolidin-1-ylphenyl]heptanamide.
| Compound Name | N-[3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-4-pyrrolidin-1-ylphenyl]heptanamide |
|---|---|
| PubChem CID | 46110215 |
| Molecular Formula | C27H39N3O5S |
| Molecular Weight | 517.69 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | N-[3-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]-4-pyrrolidin-1-ylphenyl]heptanamide |
| SMILES | CCCCCCC(=O)Nc1ccc(N2CCCC2)c(S(=O)(=O)NCCc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C27H39N3O5S/c1-4-5-6-7-10-27(31)29-22-12-13-23(30-17-8-9-18-30)26(20-22)36(32,33)28-16-15-21-11-14-24(34-2)25(19-21)35-3/h11-14,19-20,28H,4-10,15-18H2,1-3H3,(H,29,31) |
| InChIKey | GINHFWURFNQHMP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.69 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|