C31H40N4O4S — CID 98394961
N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]hexanamide (PubChem CID 98394961) has the molecular formula C31H40N4O4S and a molecular weight of 564.75 g/mol. Its IUPAC name is N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]hexanamide.
| Compound Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 98394961 |
| Molecular Formula | C31H40N4O4S |
| Molecular Weight | 564.75 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccc(N2CCN(c3ccccc3OC)CC2)c(S(=O)(=O)N[C@H](C)c2ccccc2)c1 |
| InChI | InChI=1S/C31H40N4O4S/c1-4-5-7-16-31(36)32-26-17-18-28(30(23-26)40(37,38)33-24(2)25-12-8-6-9-13-25)35-21-19-34(20-22-35)27-14-10-11-15-29(27)39-3/h6,8-15,17-18,23-24,33H,4-5,7,16,19-22H2,1-3H3,(H,32,36)/t24-/m1/s1 |
| InChIKey | ZELRNTIIOKNTTP-XMMPIXPASA-N |
| XLogP | 5.58 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.75 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|