C30H41N3O5S — CID 98640098
ethyl (3R)-1-[4-(3-cyclopentylpropanoylamino)-2-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]piperidine-3-carboxylate (PubChem CID 98640098) has the molecular formula C30H41N3O5S and a molecular weight of 555.74 g/mol. Its IUPAC name is ethyl (3R)-1-[4-(3-cyclopentylpropanoylamino)-2-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[4-(3-cyclopentylpropanoylamino)-2-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 98640098 |
| Molecular Formula | C30H41N3O5S |
| Molecular Weight | 555.74 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | ethyl (3R)-1-[4-(3-cyclopentylpropanoylamino)-2-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(c2ccc(NC(=O)CCC3CCCC3)cc2S(=O)(=O)N[C@H](C)c2ccccc2)C1 |
| InChI | InChI=1S/C30H41N3O5S/c1-3-38-30(35)25-14-9-19-33(21-25)27-17-16-26(31-29(34)18-15-23-10-7-8-11-23)20-28(27)39(36,37)32-22(2)24-12-5-4-6-13-24/h4-6,12-13,16-17,20,22-23,25,32H,3,7-11,14-15,18-19,21H2,1-2H3,(H,31,34)/t22-,25-/m1/s1 |
| InChIKey | HPRQYSYKCRWPRM-RCZVLFRGSA-N |
| XLogP | 5.41 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.74 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|