C30H33N3O7S — CID 98417359
ethyl (3S)-1-[4-(1,3-benzodioxole-5-carbonylamino)-2-[[(1S)-1-phenylethyl]sulfamoyl]phenyl]piperidine-3-carboxylate (PubChem CID 98417359) has the molecular formula C30H33N3O7S and a molecular weight of 579.68 g/mol. Its IUPAC name is ethyl (3S)-1-[4-(1,3-benzodioxole-5-carbonylamino)-2-[[(1S)-1-phenylethyl]sulfamoyl]phenyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[4-(1,3-benzodioxole-5-carbonylamino)-2-[[(1S)-1-phenylethyl]sulfamoyl]phenyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 98417359 |
| Molecular Formula | C30H33N3O7S |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | ethyl (3S)-1-[4-(1,3-benzodioxole-5-carbonylamino)-2-[[(1S)-1-phenylethyl]sulfamoyl]phenyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(c2ccc(NC(=O)c3ccc4c(c3)OCO4)cc2S(=O)(=O)N[C@@H](C)c2ccccc2)C1 |
| InChI | InChI=1S/C30H33N3O7S/c1-3-38-30(35)23-10-7-15-33(18-23)25-13-12-24(31-29(34)22-11-14-26-27(16-22)40-19-39-26)17-28(25)41(36,37)32-20(2)21-8-5-4-6-9-21/h4-6,8-9,11-14,16-17,20,23,32H,3,7,10,15,18-19H2,1-2H3,(H,31,34)/t20-,23-/m0/s1 |
| InChIKey | OGMHPEOPRMRSLJ-REWPJTCUSA-N |
| XLogP | 4.49 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|