C29H39N3O5S — CID 98410166
ethyl (3S)-1-[4-(cyclohexanecarbonylamino)-2-[[(1S)-1-phenylethyl]sulfamoyl]phenyl]piperidine-3-carboxylate (PubChem CID 98410166) has the molecular formula C29H39N3O5S and a molecular weight of 541.71 g/mol. Its IUPAC name is ethyl (3S)-1-[4-(cyclohexanecarbonylamino)-2-[[(1S)-1-phenylethyl]sulfamoyl]phenyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[4-(cyclohexanecarbonylamino)-2-[[(1S)-1-phenylethyl]sulfamoyl]phenyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 98410166 |
| Molecular Formula | C29H39N3O5S |
| Molecular Weight | 541.71 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | ethyl (3S)-1-[4-(cyclohexanecarbonylamino)-2-[[(1S)-1-phenylethyl]sulfamoyl]phenyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(c2ccc(NC(=O)C3CCCCC3)cc2S(=O)(=O)N[C@@H](C)c2ccccc2)C1 |
| InChI | InChI=1S/C29H39N3O5S/c1-3-37-29(34)24-15-10-18-32(20-24)26-17-16-25(30-28(33)23-13-8-5-9-14-23)19-27(26)38(35,36)31-21(2)22-11-6-4-7-12-22/h4,6-7,11-12,16-17,19,21,23-24,31H,3,5,8-10,13-15,18,20H2,1-2H3,(H,30,33)/t21-,24-/m0/s1 |
| InChIKey | QQWYLVFKSRAWPE-URXFXBBRSA-N |
| XLogP | 5.02 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.71 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|