C22H27ClN4O4S — CID 93018894
1-[4-[(2-chloroacetyl)amino]-2-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]piperidine-4-carboxamide (PubChem CID 93018894) has the molecular formula C22H27ClN4O4S and a molecular weight of 479.00 g/mol. Its IUPAC name is 1-[4-[(2-chloroacetyl)amino]-2-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[(2-chloroacetyl)amino]-2-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 93018894 |
| Molecular Formula | C22H27ClN4O4S |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 1-[4-[(2-chloroacetyl)amino]-2-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]piperidine-4-carboxamide |
| SMILES | C[C@@H](NS(=O)(=O)c1cc(NC(=O)CCl)ccc1N1CCC(C(N)=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H27ClN4O4S/c1-15(16-5-3-2-4-6-16)26-32(30,31)20-13-18(25-21(28)14-23)7-8-19(20)27-11-9-17(10-12-27)22(24)29/h2-8,13,15,17,26H,9-12,14H2,1H3,(H2,24,29)(H,25,28)/t15-/m1/s1 |
| InChIKey | IBXYUGHHJRBNON-OAHLLOKOSA-N |
| XLogP | 2.61 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|