C30H34ClN3O5S — CID 99729573
ethyl (3R)-1-[4-[[(2S)-2-chloro-2-phenylacetyl]amino]-2-[[(1S)-1-phenylethyl]sulfamoyl]phenyl]piperidine-3-carboxylate (PubChem CID 99729573) has the molecular formula C30H34ClN3O5S and a molecular weight of 584.14 g/mol. Its IUPAC name is ethyl (3R)-1-[4-[[(2S)-2-chloro-2-phenylacetyl]amino]-2-[[(1S)-1-phenylethyl]sulfamoyl]phenyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[4-[[(2S)-2-chloro-2-phenylacetyl]amino]-2-[[(1S)-1-phenylethyl]sulfamoyl]phenyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 99729573 |
| Molecular Formula | C30H34ClN3O5S |
| Molecular Weight | 584.14 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | ethyl (3R)-1-[4-[[(2S)-2-chloro-2-phenylacetyl]amino]-2-[[(1S)-1-phenylethyl]sulfamoyl]phenyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(c2ccc(NC(=O)[C@@H](Cl)c3ccccc3)cc2S(=O)(=O)N[C@@H](C)c2ccccc2)C1 |
| InChI | InChI=1S/C30H34ClN3O5S/c1-3-39-30(36)24-15-10-18-34(20-24)26-17-16-25(32-29(35)28(31)23-13-8-5-9-14-23)19-27(26)40(37,38)33-21(2)22-11-6-4-7-12-22/h4-9,11-14,16-17,19,21,24,28,33H,3,10,15,18,20H2,1-2H3,(H,32,35)/t21-,24+,28-/m0/s1 |
| InChIKey | PHPIJWJXDIZVDV-YBZFOXLFSA-N |
| XLogP | 5.42 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.14 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|