C24H29Cl2N3O5S — CID 98640065
ethyl (3S)-1-[4-[(2,2-dichloroacetyl)amino]-2-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]piperidine-3-carboxylate (PubChem CID 98640065) has the molecular formula C24H29Cl2N3O5S and a molecular weight of 542.49 g/mol. Its IUPAC name is ethyl (3S)-1-[4-[(2,2-dichloroacetyl)amino]-2-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[4-[(2,2-dichloroacetyl)amino]-2-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 98640065 |
| Molecular Formula | C24H29Cl2N3O5S |
| Molecular Weight | 542.49 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | ethyl (3S)-1-[4-[(2,2-dichloroacetyl)amino]-2-[[(1R)-1-phenylethyl]sulfamoyl]phenyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(c2ccc(NC(=O)C(Cl)Cl)cc2S(=O)(=O)N[C@H](C)c2ccccc2)C1 |
| InChI | InChI=1S/C24H29Cl2N3O5S/c1-3-34-24(31)18-10-7-13-29(15-18)20-12-11-19(27-23(30)22(25)26)14-21(20)35(32,33)28-16(2)17-8-5-4-6-9-17/h4-6,8-9,11-12,14,16,18,22,28H,3,7,10,13,15H2,1-2H3,(H,27,30)/t16-,18+/m1/s1 |
| InChIKey | LHJQNOIUYJQETO-AEFFLSMTSA-N |
| XLogP | 4.25 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|