C29H32BrN3O5S — CID 46110471
ethyl 1-[4-[(4-bromobenzoyl)amino]-2-(1-phenylethylsulfamoyl)phenyl]piperidine-3-carboxylate (PubChem CID 46110471) has the molecular formula C29H32BrN3O5S and a molecular weight of 614.56 g/mol. Its IUPAC name is ethyl 1-[4-[(4-bromobenzoyl)amino]-2-(1-phenylethylsulfamoyl)phenyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[4-[(4-bromobenzoyl)amino]-2-(1-phenylethylsulfamoyl)phenyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 46110471 |
| Molecular Formula | C29H32BrN3O5S |
| Molecular Weight | 614.56 g/mol |
| Exact Mass | 613.12 |
| IUPAC Name | ethyl 1-[4-[(4-bromobenzoyl)amino]-2-(1-phenylethylsulfamoyl)phenyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ccc(NC(=O)c3ccc(Br)cc3)cc2S(=O)(=O)NC(C)c2ccccc2)C1 |
| InChI | InChI=1S/C29H32BrN3O5S/c1-3-38-29(35)23-10-7-17-33(19-23)26-16-15-25(31-28(34)22-11-13-24(30)14-12-22)18-27(26)39(36,37)32-20(2)21-8-5-4-6-9-21/h4-6,8-9,11-16,18,20,23,32H,3,7,10,17,19H2,1-2H3,(H,31,34) |
| InChIKey | USOJKPMYNSZBLM-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.56 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|